BDBM592507 US11572371, Compound 19
SMILES CC(C)c1nnc(CC2N=C(c3c(C)c(C)sc3-n3c(C)nnc23)c2ccc(Cl)cc2)o1
InChI Key InChIKey=NHQWTZLQTWSZGU-UHFFFAOYSA-N
Data 4 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 4 hits for monomerid = 592507
Affinity DataIC50: 8.30nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair
Affinity DataIC50: 51nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair
Affinity DataIC50: 17nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair
Affinity DataIC50: 21nMAssay Description:Homogeneous time=resolved fluorescence (HTRF) was used to detect the binding of the compound to BRD4(D1 + D2) and BRDT (D1) proteins, and the AlphaSc...More data for this Ligand-Target Pair